C11H16F3N3 — CID 64757389
1-methyl-N-[3-(trifluoromethyl)cyclohexyl]pyrazol-3-amine (PubChem CID 64757389) has the molecular formula C11H16F3N3 and a molecular weight of 247.26 g/mol. Its IUPAC name is 1-methyl-N-[3-(trifluoromethyl)cyclohexyl]pyrazol-3-amine.
| Compound Name | 1-methyl-N-[3-(trifluoromethyl)cyclohexyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 64757389 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-methyl-N-[3-(trifluoromethyl)cyclohexyl]pyrazol-3-amine |
| SMILES | Cn1ccc(NC2CCCC(C(F)(F)F)C2)n1 |
| InChI | InChI=1S/C11H16F3N3/c1-17-6-5-10(16-17)15-9-4-2-3-8(7-9)11(12,13)14/h5-6,8-9H,2-4,7H2,1H3,(H,15,16) |
| InChIKey | PDXUEEGGAHOZBG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |