C14H24F3N — CID 64757641
2-methyl-N-[[7-(trifluoromethyl)spiro[2.5]octan-2-yl]methyl]propan-2-amine (PubChem CID 64757641) has the molecular formula C14H24F3N and a molecular weight of 263.35 g/mol. Its IUPAC name is 2-methyl-N-[[7-(trifluoromethyl)spiro[2.5]octan-2-yl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[7-(trifluoromethyl)spiro[2.5]octan-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 64757641 |
| Molecular Formula | C14H24F3N |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-methyl-N-[[7-(trifluoromethyl)spiro[2.5]octan-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)(C)NCC1CC12CCCC(C(F)(F)F)C2 |
| InChI | InChI=1S/C14H24F3N/c1-12(2,3)18-9-11-8-13(11)6-4-5-10(7-13)14(15,16)17/h10-11,18H,4-9H2,1-3H3 |
| InChIKey | XSBJVQNBCVDNHV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |