C19H30ClN — CID 64766686
2-[1-(2-chlorophenyl)-2-methylpropan-2-yl]-N-ethyl-5-methylcyclohexan-1-amine (PubChem CID 64766686) has the molecular formula C19H30ClN and a molecular weight of 307.91 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)-2-methylpropan-2-yl]-N-ethyl-5-methylcyclohexan-1-amine.
| Compound Name | 2-[1-(2-chlorophenyl)-2-methylpropan-2-yl]-N-ethyl-5-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64766686 |
| Molecular Formula | C19H30ClN |
| Molecular Weight | 307.91 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 2-[1-(2-chlorophenyl)-2-methylpropan-2-yl]-N-ethyl-5-methylcyclohexan-1-amine |
| SMILES | CCNC1CC(C)CCC1C(C)(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C19H30ClN/c1-5-21-18-12-14(2)10-11-16(18)19(3,4)13-15-8-6-7-9-17(15)20/h6-9,14,16,18,21H,5,10-13H2,1-4H3 |
| InChIKey | VKAIVESZYYUWAI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.91 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |