C18H21BrFN — CID 64768760
1-(2-bromophenyl)-3-(4-fluorophenyl)-N,3-dimethylbutan-2-amine (PubChem CID 64768760) has the molecular formula C18H21BrFN and a molecular weight of 350.28 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-(4-fluorophenyl)-N,3-dimethylbutan-2-amine.
| Compound Name | 1-(2-bromophenyl)-3-(4-fluorophenyl)-N,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 64768760 |
| Molecular Formula | C18H21BrFN |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 1-(2-bromophenyl)-3-(4-fluorophenyl)-N,3-dimethylbutan-2-amine |
| SMILES | CNC(Cc1ccccc1Br)C(C)(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H21BrFN/c1-18(2,14-8-10-15(20)11-9-14)17(21-3)12-13-6-4-5-7-16(13)19/h4-11,17,21H,12H2,1-3H3 |
| InChIKey | HMOKGRGUELAALN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |