C16H27ClN4 — CID 64778323
1-(2-chloroethyl)-4-[(1-cyclopentylpyrazol-3-yl)methyl]-1,4-diazepane (PubChem CID 64778323) has the molecular formula C16H27ClN4 and a molecular weight of 310.87 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-[(1-cyclopentylpyrazol-3-yl)methyl]-1,4-diazepane.
| Compound Name | 1-(2-chloroethyl)-4-[(1-cyclopentylpyrazol-3-yl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 64778323 |
| Molecular Formula | C16H27ClN4 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-(2-chloroethyl)-4-[(1-cyclopentylpyrazol-3-yl)methyl]-1,4-diazepane |
| SMILES | ClCCN1CCCN(Cc2ccn(C3CCCC3)n2)CC1 |
| InChI | InChI=1S/C16H27ClN4/c17-7-11-19-8-3-9-20(13-12-19)14-15-6-10-21(18-15)16-4-1-2-5-16/h6,10,16H,1-5,7-9,11-14H2 |
| InChIKey | QYWXDLABBZCXCH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|