C14H14Cl2N2O2 — CID 64787134
4-chloro-N-(3-chloro-4-hydroxyphenyl)-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 64787134) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is 4-chloro-N-(3-chloro-4-hydroxyphenyl)-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-(3-chloro-4-hydroxyphenyl)-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 64787134 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-chloro-N-(3-chloro-4-hydroxyphenyl)-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(C)n1cc(Cl)cc1C(=O)Nc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-8(2)18-7-9(15)5-12(18)14(20)17-10-3-4-13(19)11(16)6-10/h3-8,19H,1-2H3,(H,17,20) |
| InChIKey | DGNIMUGZSKNEIY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|