C14H28F3N3O — CID 64790691
2-methyl-2-(methylamino)-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]hexan-1-ol (PubChem CID 64790691) has the molecular formula C14H28F3N3O and a molecular weight of 311.39 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]hexan-1-ol.
| Compound Name | 2-methyl-2-(methylamino)-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]hexan-1-ol |
|---|---|
| PubChem CID | 64790691 |
| Molecular Formula | C14H28F3N3O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 2-methyl-2-(methylamino)-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]hexan-1-ol |
| SMILES | CNC(C)(CO)CCCCN1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H28F3N3O/c1-13(12-21,18-2)5-3-4-6-19-7-9-20(10-8-19)11-14(15,16)17/h18,21H,3-12H2,1-2H3 |
| InChIKey | SFODHQJAOKEABJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|