C19H19NO4 — CID 6479502
ethyl (E)-6-(1-benzylpyrrol-2-yl)-2,4-dioxohex-5-enoate (PubChem CID 6479502) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is ethyl (E)-6-(1-benzylpyrrol-2-yl)-2,4-dioxohex-5-enoate.
| Compound Name | ethyl (E)-6-(1-benzylpyrrol-2-yl)-2,4-dioxohex-5-enoate |
|---|---|
| PubChem CID | 6479502 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | ethyl (E)-6-(1-benzylpyrrol-2-yl)-2,4-dioxohex-5-enoate |
| SMILES | CCOC(=O)C(=O)CC(=O)/C=C/c1cccn1Cc1ccccc1 |
| InChI | InChI=1S/C19H19NO4/c1-2-24-19(23)18(22)13-17(21)11-10-16-9-6-12-20(16)14-15-7-4-3-5-8-15/h3-12H,2,13-14H2,1H3/b11-10+ |
| InChIKey | MGNPFVTUIUNTGW-ZHACJKMWSA-N |
| XLogP | 2.64 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|