C13H14N2S — CID 648057
6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (PubChem CID 648057) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine.
| Compound Name | 6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 648057 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(s1)CC(c1ccccc1)CC2 |
| InChI | InChI=1S/C13H14N2S/c14-13-15-11-7-6-10(8-12(11)16-13)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,14,15) |
| InChIKey | ULKFNJBNISYXTB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |