C16H10ClNO4S — CID 6480743
methyl 5-anilino-6-chloro-4,7-dioxo-1-benzothiophene-2-carboxylate (PubChem CID 6480743) has the molecular formula C16H10ClNO4S and a molecular weight of 347.78 g/mol. Its IUPAC name is methyl 5-anilino-6-chloro-4,7-dioxo-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5-anilino-6-chloro-4,7-dioxo-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 6480743 |
| Molecular Formula | C16H10ClNO4S |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | methyl 5-anilino-6-chloro-4,7-dioxo-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(s1)C(=O)C(Cl)=C(Nc1ccccc1)C2=O |
| InChI | InChI=1S/C16H10ClNO4S/c1-22-16(21)10-7-9-13(19)12(11(17)14(20)15(9)23-10)18-8-5-3-2-4-6-8/h2-7,18H,1H3 |
| InChIKey | WDOIJGVKHQYWLK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|