C13H17Cl2NOS — CID 64807605
2-(cyclopropylamino)-4-(2,5-dichlorophenyl)sulfanylbutan-1-ol (PubChem CID 64807605) has the molecular formula C13H17Cl2NOS and a molecular weight of 306.26 g/mol. Its IUPAC name is 2-(cyclopropylamino)-4-(2,5-dichlorophenyl)sulfanylbutan-1-ol.
| Compound Name | 2-(cyclopropylamino)-4-(2,5-dichlorophenyl)sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 64807605 |
| Molecular Formula | C13H17Cl2NOS |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 2-(cyclopropylamino)-4-(2,5-dichlorophenyl)sulfanylbutan-1-ol |
| SMILES | OCC(CCSc1cc(Cl)ccc1Cl)NC1CC1 |
| InChI | InChI=1S/C13H17Cl2NOS/c14-9-1-4-12(15)13(7-9)18-6-5-11(8-17)16-10-2-3-10/h1,4,7,10-11,16-17H,2-3,5-6,8H2 |
| InChIKey | RFDVWZZCXDRBDV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |