C15H21N3 — CID 64813916
2-(5,6-dimethyl-1H-benzimidazol-2-yl)cyclohexan-1-amine (PubChem CID 64813916) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1H-benzimidazol-2-yl)cyclohexan-1-amine.
| Compound Name | 2-(5,6-dimethyl-1H-benzimidazol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64813916 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2-(5,6-dimethyl-1H-benzimidazol-2-yl)cyclohexan-1-amine |
| SMILES | Cc1cc2nc(C3CCCCC3N)[nH]c2cc1C |
| InChI | InChI=1S/C15H21N3/c1-9-7-13-14(8-10(9)2)18-15(17-13)11-5-3-4-6-12(11)16/h7-8,11-12H,3-6,16H2,1-2H3,(H,17,18) |
| InChIKey | OPFGYKWLFSHDKB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |