C13H15Cl2N3 — CID 82001526
[2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine (PubChem CID 82001526) has the molecular formula C13H15Cl2N3 and a molecular weight of 284.19 g/mol. Its IUPAC name is [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine.
| Compound Name | [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 82001526 |
| Molecular Formula | C13H15Cl2N3 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine |
| SMILES | NCC1CCCC1c1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C13H15Cl2N3/c14-9-4-11-12(5-10(9)15)18-13(17-11)8-3-1-2-7(8)6-16/h4-5,7-8H,1-3,6,16H2,(H,17,18) |
| InChIKey | RBYSJGFEWRISGQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |