About [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine
[2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine (PubChem CID 82001526) has the molecular formula C13H15Cl2N3
and a molecular weight of 284.19 g/mol. Its IUPAC name is [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine.
Molecular Properties
| Compound Name | [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine |
| PubChem CID | 82001526 |
| Molecular Formula | C13H15Cl2N3 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine |
| SMILES | NCC1CCCC1c1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C13H15Cl2N3/c14-9-4-11-12(5-10(9)15)18-13(17-11)8-3-1-2-7(8)6-16/h4-5,7-8H,1-3,6,16H2,(H,17,18) |
| InChIKey | RBYSJGFEWRISGQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine?
The IUPAC name of [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine (CID 82001526) is [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine.
What is the SMILES notation for [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine?
The canonical SMILES for [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine is NCC1CCCC1c1nc2cc(Cl)c(Cl)cc2[nH]1.
What is the InChIKey of [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine?
The InChIKey is RBYSJGFEWRISGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2N3/c14-9-4-11-12(5-10(9)15)18-13(17-11)8-3-1-2-7(8)6-16/h4-5,7-8H,1-3,6,16H2,(H,17,18).
What are the key properties of [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine?
[2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine has a molecular weight of 284.19 g/mol, XLogP of 3.71, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5,6-dichloro-1H-benzimidazol-2-yl)cyclopentyl]methanamine is sourced from PubChem (CID 82001526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).