C13H12Cl2N2 — CID 82003889
2-(3-bicyclo[3.1.0]hexanyl)-5,6-dichloro-1H-benzimidazole (PubChem CID 82003889) has the molecular formula C13H12Cl2N2 and a molecular weight of 267.16 g/mol. Its IUPAC name is 2-(3-bicyclo[3.1.0]hexanyl)-5,6-dichloro-1H-benzimidazole.
| Compound Name | 2-(3-bicyclo[3.1.0]hexanyl)-5,6-dichloro-1H-benzimidazole |
|---|---|
| PubChem CID | 82003889 |
| Molecular Formula | C13H12Cl2N2 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 2-(3-bicyclo[3.1.0]hexanyl)-5,6-dichloro-1H-benzimidazole |
| SMILES | Clc1cc2nc(C3CC4CC4C3)[nH]c2cc1Cl |
| InChI | InChI=1S/C13H12Cl2N2/c14-9-4-11-12(5-10(9)15)17-13(16-11)8-2-6-1-7(6)3-8/h4-8H,1-3H2,(H,16,17) |
| InChIKey | KQXKTAAMNNJNIN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |