About 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide
4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide (PubChem CID 110611063) has the molecular formula C15H20Cl2N4O2S
and a molecular weight of 391.32 g/mol. Its IUPAC name is 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide |
| PubChem CID | 110611063 |
| Molecular Formula | C15H20Cl2N4O2S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide |
| SMILES | CCCNS(=O)(=O)N1CCC(c2nc3cc(Cl)c(Cl)cc3[nH]2)CC1 |
| InChI | InChI=1S/C15H20Cl2N4O2S/c1-2-5-18-24(22,23)21-6-3-10(4-7-21)15-19-13-8-11(16)12(17)9-14(13)20-15/h8-10,18H,2-7H2,1H3,(H,19,20) |
| InChIKey | PRVPRYMWBQITJD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide?
The IUPAC name of 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide (CID 110611063) is 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide.
What is the SMILES notation for 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide?
The canonical SMILES for 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide is CCCNS(=O)(=O)N1CCC(c2nc3cc(Cl)c(Cl)cc3[nH]2)CC1.
What is the InChIKey of 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide?
The InChIKey is PRVPRYMWBQITJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20Cl2N4O2S/c1-2-5-18-24(22,23)21-6-3-10(4-7-21)15-19-13-8-11(16)12(17)9-14(13)20-15/h8-10,18H,2-7H2,1H3,(H,19,20).
What are the key properties of 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide?
4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide has a molecular weight of 391.32 g/mol, XLogP of 3.29, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-propylpiperidine-1-sulfonamide is sourced from PubChem (CID 110611063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).