C13H16Cl2N4O2S — CID 110611061
4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-methylpiperidine-1-sulfonamide (PubChem CID 110611061) has the molecular formula C13H16Cl2N4O2S and a molecular weight of 363.27 g/mol. Its IUPAC name is 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-methylpiperidine-1-sulfonamide.
| Compound Name | 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 110611061 |
| Molecular Formula | C13H16Cl2N4O2S |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-methylpiperidine-1-sulfonamide |
| SMILES | CNS(=O)(=O)N1CCC(c2nc3cc(Cl)c(Cl)cc3[nH]2)CC1 |
| InChI | InChI=1S/C13H16Cl2N4O2S/c1-16-22(20,21)19-4-2-8(3-5-19)13-17-11-6-9(14)10(15)7-12(11)18-13/h6-8,16H,2-5H2,1H3,(H,17,18) |
| InChIKey | JXNHGCCGDMZTQU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |