C15H18ClNO4 — CID 64814516
2-[3-(3-chlorophenoxy)propanoylamino]cyclopentane-1-carboxylic acid (PubChem CID 64814516) has the molecular formula C15H18ClNO4 and a molecular weight of 311.76 g/mol. Its IUPAC name is 2-[3-(3-chlorophenoxy)propanoylamino]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[3-(3-chlorophenoxy)propanoylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 64814516 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[3-(3-chlorophenoxy)propanoylamino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(CCOc1cccc(Cl)c1)NC1CCCC1C(=O)O |
| InChI | InChI=1S/C15H18ClNO4/c16-10-3-1-4-11(9-10)21-8-7-14(18)17-13-6-2-5-12(13)15(19)20/h1,3-4,9,12-13H,2,5-8H2,(H,17,18)(H,19,20) |
| InChIKey | UBIKGVUDQFGMOT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |