C13H11BrClNO2 — CID 64835922
3-(5-bromo-2-chlorophenyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 64835922) has the molecular formula C13H11BrClNO2 and a molecular weight of 328.59 g/mol. Its IUPAC name is 3-(5-bromo-2-chlorophenyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-(5-bromo-2-chlorophenyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 64835922 |
| Molecular Formula | C13H11BrClNO2 |
| Molecular Weight | 328.59 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 3-(5-bromo-2-chlorophenyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | CC1(C)C2C(=O)N(c3cc(Br)ccc3Cl)C(=O)C21 |
| InChI | InChI=1S/C13H11BrClNO2/c1-13(2)9-10(13)12(18)16(11(9)17)8-5-6(14)3-4-7(8)15/h3-5,9-10H,1-2H3 |
| InChIKey | WTHOZBCPGSALHG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|