C14H26N4 — CID 64838757
2-ethyl-2,5,5-trimethyl-1-(2-pyrazol-1-ylethyl)piperazine (PubChem CID 64838757) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-ethyl-2,5,5-trimethyl-1-(2-pyrazol-1-ylethyl)piperazine.
| Compound Name | 2-ethyl-2,5,5-trimethyl-1-(2-pyrazol-1-ylethyl)piperazine |
|---|---|
| PubChem CID | 64838757 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | 2-ethyl-2,5,5-trimethyl-1-(2-pyrazol-1-ylethyl)piperazine |
| SMILES | CCC1(C)CNC(C)(C)CN1CCn1cccn1 |
| InChI | InChI=1S/C14H26N4/c1-5-14(4)11-15-13(2,3)12-17(14)9-10-18-8-6-7-16-18/h6-8,15H,5,9-12H2,1-4H3 |
| InChIKey | OKBLRNWWNGYLBK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |