C14H30N2O2S — CID 65097594
2-ethyl-1-(3-ethylsulfonylpropyl)-2,5,5-trimethylpiperazine (PubChem CID 65097594) has the molecular formula C14H30N2O2S and a molecular weight of 290.47 g/mol. Its IUPAC name is 2-ethyl-1-(3-ethylsulfonylpropyl)-2,5,5-trimethylpiperazine.
| Compound Name | 2-ethyl-1-(3-ethylsulfonylpropyl)-2,5,5-trimethylpiperazine |
|---|---|
| PubChem CID | 65097594 |
| Molecular Formula | C14H30N2O2S |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-ethyl-1-(3-ethylsulfonylpropyl)-2,5,5-trimethylpiperazine |
| SMILES | CCC1(C)CNC(C)(C)CN1CCCS(=O)(=O)CC |
| InChI | InChI=1S/C14H30N2O2S/c1-6-14(5)11-15-13(3,4)12-16(14)9-8-10-19(17,18)7-2/h15H,6-12H2,1-5H3 |
| InChIKey | WOICQOXBVQKPRK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |