C15H32N2O2S — CID 65097597
2,5-diethyl-1-(3-ethylsulfonylpropyl)-2,5-dimethylpiperazine (PubChem CID 65097597) has the molecular formula C15H32N2O2S and a molecular weight of 304.50 g/mol. Its IUPAC name is 2,5-diethyl-1-(3-ethylsulfonylpropyl)-2,5-dimethylpiperazine.
| Compound Name | 2,5-diethyl-1-(3-ethylsulfonylpropyl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 65097597 |
| Molecular Formula | C15H32N2O2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2,5-diethyl-1-(3-ethylsulfonylpropyl)-2,5-dimethylpiperazine |
| SMILES | CCC1(C)CN(CCCS(=O)(=O)CC)C(C)(CC)CN1 |
| InChI | InChI=1S/C15H32N2O2S/c1-6-14(4)13-17(15(5,7-2)12-16-14)10-9-11-20(18,19)8-3/h16H,6-13H2,1-5H3 |
| InChIKey | ZQWBZVGEYBOICV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |