About 8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane
8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane (PubChem CID 64843228) has the molecular formula C14H26F2N2
and a molecular weight of 260.37 g/mol. Its IUPAC name is 8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane |
| PubChem CID | 64843228 |
| Molecular Formula | C14H26F2N2 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane |
| SMILES | CC(C)(C)C1CN(CC(F)F)C2(CCCC2)CN1 |
| InChI | InChI=1S/C14H26F2N2/c1-13(2,3)11-8-18(9-12(15)16)14(10-17-11)6-4-5-7-14/h11-12,17H,4-10H2,1-3H3 |
| InChIKey | XNASWXGEIFZKGS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane?
The IUPAC name of 8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane (CID 64843228) is 8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane.
What is the SMILES notation for 8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane?
The canonical SMILES for 8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane is CC(C)(C)C1CN(CC(F)F)C2(CCCC2)CN1.
What is the InChIKey of 8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane?
The InChIKey is XNASWXGEIFZKGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F2N2/c1-13(2,3)11-8-18(9-12(15)16)14(10-17-11)6-4-5-7-14/h11-12,17H,4-10H2,1-3H3.
What are the key properties of 8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane?
8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane has a molecular weight of 260.37 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-6-(2,2-difluoroethyl)-6,9-diazaspiro[4.5]decane is sourced from PubChem (CID 64843228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).