C16H28N2S — CID 64846151
2-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-5-methylpiperazine (PubChem CID 64846151) has the molecular formula C16H28N2S and a molecular weight of 280.48 g/mol. Its IUPAC name is 2-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-5-methylpiperazine.
| Compound Name | 2-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-5-methylpiperazine |
|---|---|
| PubChem CID | 64846151 |
| Molecular Formula | C16H28N2S |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-5-methylpiperazine |
| SMILES | CCc1ccc(CN2CC(C)NCC2C(C)(C)C)s1 |
| InChI | InChI=1S/C16H28N2S/c1-6-13-7-8-14(19-13)11-18-10-12(2)17-9-15(18)16(3,4)5/h7-8,12,15,17H,6,9-11H2,1-5H3 |
| InChIKey | BJXIQCBELIECMQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |