C16H21FN2O — CID 64855633
2-(cyclopropylamino)-5-(2-fluoro-5-methylphenoxy)-2-methylpentanenitrile (PubChem CID 64855633) has the molecular formula C16H21FN2O and a molecular weight of 276.35 g/mol. Its IUPAC name is 2-(cyclopropylamino)-5-(2-fluoro-5-methylphenoxy)-2-methylpentanenitrile.
| Compound Name | 2-(cyclopropylamino)-5-(2-fluoro-5-methylphenoxy)-2-methylpentanenitrile |
|---|---|
| PubChem CID | 64855633 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-(cyclopropylamino)-5-(2-fluoro-5-methylphenoxy)-2-methylpentanenitrile |
| SMILES | Cc1ccc(F)c(OCCCC(C)(C#N)NC2CC2)c1 |
| InChI | InChI=1S/C16H21FN2O/c1-12-4-7-14(17)15(10-12)20-9-3-8-16(2,11-18)19-13-5-6-13/h4,7,10,13,19H,3,5-6,8-9H2,1-2H3 |
| InChIKey | CXCPMVGKWCPCDV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|