C15H28N2 — CID 64878190
4-prop-2-enyl-3-propyl-1,4-diazaspiro[5.5]undecane (PubChem CID 64878190) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 4-prop-2-enyl-3-propyl-1,4-diazaspiro[5.5]undecane.
| Compound Name | 4-prop-2-enyl-3-propyl-1,4-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 64878190 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 4-prop-2-enyl-3-propyl-1,4-diazaspiro[5.5]undecane |
| SMILES | C=CCN1CC2(CCCCC2)NCC1CCC |
| InChI | InChI=1S/C15H28N2/c1-3-8-14-12-16-15(9-6-5-7-10-15)13-17(14)11-4-2/h4,14,16H,2-3,5-13H2,1H3 |
| InChIKey | VJLNVUGEDKKFGR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|