C15H20N2O2S — CID 64882632
10-(2-thiophen-3-ylethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione (PubChem CID 64882632) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 10-(2-thiophen-3-ylethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione.
| Compound Name | 10-(2-thiophen-3-ylethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione |
|---|---|
| PubChem CID | 64882632 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 10-(2-thiophen-3-ylethyl)-6,10-diazaspiro[4.6]undecane-7,11-dione |
| SMILES | O=C1CCN(CCc2ccsc2)C(=O)C2(CCCC2)N1 |
| InChI | InChI=1S/C15H20N2O2S/c18-13-4-9-17(8-3-12-5-10-20-11-12)14(19)15(16-13)6-1-2-7-15/h5,10-11H,1-4,6-9H2,(H,16,18) |
| InChIKey | OHJIUASOJABQCH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |