C15H22N4O2 — CID 64882771
11-(2-pyrazol-1-ylethyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione (PubChem CID 64882771) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 11-(2-pyrazol-1-ylethyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione.
| Compound Name | 11-(2-pyrazol-1-ylethyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione |
|---|---|
| PubChem CID | 64882771 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 11-(2-pyrazol-1-ylethyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione |
| SMILES | O=C1CCN(CCn2cccn2)C(=O)C2(CCCCC2)N1 |
| InChI | InChI=1S/C15H22N4O2/c20-13-5-10-18(11-12-19-9-4-8-16-19)14(21)15(17-13)6-2-1-3-7-15/h4,8-9H,1-3,5-7,10-12H2,(H,17,20) |
| InChIKey | HMFXBXWUGPTUDN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |