C16H28N2O2 — CID 64883163
11-(3,3-dimethylbutyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione (PubChem CID 64883163) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 11-(3,3-dimethylbutyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione.
| Compound Name | 11-(3,3-dimethylbutyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione |
|---|---|
| PubChem CID | 64883163 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 11-(3,3-dimethylbutyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione |
| SMILES | CC(C)(C)CCN1CCC(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C16H28N2O2/c1-15(2,3)10-12-18-11-7-13(19)17-16(14(18)20)8-5-4-6-9-16/h4-12H2,1-3H3,(H,17,19) |
| InChIKey | VOJFAJMRYFIVGR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |