C16H20N2O2S — CID 64885638
3,6-dicyclopropyl-1-(2-thiophen-2-ylethyl)piperazine-2,5-dione (PubChem CID 64885638) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is 3,6-dicyclopropyl-1-(2-thiophen-2-ylethyl)piperazine-2,5-dione.
| Compound Name | 3,6-dicyclopropyl-1-(2-thiophen-2-ylethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64885638 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3,6-dicyclopropyl-1-(2-thiophen-2-ylethyl)piperazine-2,5-dione |
| SMILES | O=C1NC(C2CC2)C(=O)N(CCc2cccs2)C1C1CC1 |
| InChI | InChI=1S/C16H20N2O2S/c19-15-14(11-5-6-11)18(8-7-12-2-1-9-21-12)16(20)13(17-15)10-3-4-10/h1-2,9-11,13-14H,3-8H2,(H,17,19) |
| InChIKey | QMMRCGCNAIXNNH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |