C16H16ClFN2O3 — CID 6488653
N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methyl-2-oxo-3-pyridinyl]-2-methoxyacetamide (PubChem CID 6488653) has the molecular formula C16H16ClFN2O3 and a molecular weight of 338.77 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methyl-2-oxo-3-pyridinyl]-2-methoxyacetamide.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methyl-2-oxo-3-pyridinyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 6488653 |
| Molecular Formula | C16H16ClFN2O3 |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methyl-2-oxo-3-pyridinyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cc(C)cn(Cc2c(F)cccc2Cl)c1=O |
| InChI | InChI=1S/C16H16ClFN2O3/c1-10-6-14(19-15(21)9-23-2)16(22)20(7-10)8-11-12(17)4-3-5-13(11)18/h3-7H,8-9H2,1-2H3,(H,19,21) |
| InChIKey | SKENCUQRTFADKU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |