C9H10ClFN2O2 — CID 22732316
N-(5-amino-4-chloro-2-fluorophenyl)-2-methoxyacetamide (PubChem CID 22732316) has the molecular formula C9H10ClFN2O2 and a molecular weight of 232.64 g/mol. Its IUPAC name is N-(5-amino-4-chloro-2-fluorophenyl)-2-methoxyacetamide.
| Compound Name | N-(5-amino-4-chloro-2-fluorophenyl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 22732316 |
| Molecular Formula | C9H10ClFN2O2 |
| Molecular Weight | 232.64 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | N-(5-amino-4-chloro-2-fluorophenyl)-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cc(N)c(Cl)cc1F |
| InChI | InChI=1S/C9H10ClFN2O2/c1-15-4-9(14)13-8-3-7(12)5(10)2-6(8)11/h2-3H,4,12H2,1H3,(H,13,14) |
| InChIKey | NRXOYQQZBRTUKO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.64 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|