C16H16N2O7 — CID 6490208
methyl 2-[(4E)-4-[[4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 6490208) has the molecular formula C16H16N2O7 and a molecular weight of 348.31 g/mol. Its IUPAC name is methyl 2-[(4E)-4-[[4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(4E)-4-[[4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 6490208 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | methyl 2-[(4E)-4-[[4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | COC(=O)COc1ccc(/C=C2/NC(=O)N(CC(=O)OC)C2=O)cc1 |
| InChI | InChI=1S/C16H16N2O7/c1-23-13(19)8-18-15(21)12(17-16(18)22)7-10-3-5-11(6-4-10)25-9-14(20)24-2/h3-7H,8-9H2,1-2H3,(H,17,22)/b12-7+ |
| InChIKey | SVSMAEMVAUTICP-KPKJPENVSA-N |
| XLogP | 0.30 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|