C17H32N2O2 — CID 64902150
3-butan-2-yl-6,6-diethyl-1-(3-methylbutyl)piperazine-2,5-dione (PubChem CID 64902150) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is 3-butan-2-yl-6,6-diethyl-1-(3-methylbutyl)piperazine-2,5-dione.
| Compound Name | 3-butan-2-yl-6,6-diethyl-1-(3-methylbutyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64902150 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 3-butan-2-yl-6,6-diethyl-1-(3-methylbutyl)piperazine-2,5-dione |
| SMILES | CCC(C)C1NC(=O)C(CC)(CC)N(CCC(C)C)C1=O |
| InChI | InChI=1S/C17H32N2O2/c1-7-13(6)14-15(20)19(11-10-12(4)5)17(8-2,9-3)16(21)18-14/h12-14H,7-11H2,1-6H3,(H,18,21) |
| InChIKey | HNRQMEBERWCXON-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |