C13H24N2O2 — CID 64903585
3-ethyl-6,6-dimethyl-1-(3-methylbutyl)piperazine-2,5-dione (PubChem CID 64903585) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-ethyl-6,6-dimethyl-1-(3-methylbutyl)piperazine-2,5-dione.
| Compound Name | 3-ethyl-6,6-dimethyl-1-(3-methylbutyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64903585 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 3-ethyl-6,6-dimethyl-1-(3-methylbutyl)piperazine-2,5-dione |
| SMILES | CCC1NC(=O)C(C)(C)N(CCC(C)C)C1=O |
| InChI | InChI=1S/C13H24N2O2/c1-6-10-11(16)15(8-7-9(2)3)13(4,5)12(17)14-10/h9-10H,6-8H2,1-5H3,(H,14,17) |
| InChIKey | SALYXQOSJOSMIE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |