C12H12F2O3S — CID 64908082
3-(2,4-difluorophenyl)sulfonyl-2-methylcyclopentan-1-one (PubChem CID 64908082) has the molecular formula C12H12F2O3S and a molecular weight of 274.29 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)sulfonyl-2-methylcyclopentan-1-one.
| Compound Name | 3-(2,4-difluorophenyl)sulfonyl-2-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 64908082 |
| Molecular Formula | C12H12F2O3S |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 3-(2,4-difluorophenyl)sulfonyl-2-methylcyclopentan-1-one |
| SMILES | CC1C(=O)CCC1S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H12F2O3S/c1-7-10(15)3-5-11(7)18(16,17)12-4-2-8(13)6-9(12)14/h2,4,6-7,11H,3,5H2,1H3 |
| InChIKey | GJFISECGWNCOEQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |