C13H12ClNO4S — CID 64911304
6-chloro-5-(1,1-dioxothiolane-3-carbonyl)-1,3-dihydroindol-2-one (PubChem CID 64911304) has the molecular formula C13H12ClNO4S and a molecular weight of 313.76 g/mol. Its IUPAC name is 6-chloro-5-(1,1-dioxothiolane-3-carbonyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-(1,1-dioxothiolane-3-carbonyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 64911304 |
| Molecular Formula | C13H12ClNO4S |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 6-chloro-5-(1,1-dioxothiolane-3-carbonyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(=O)C3CCS(=O)(=O)C3)c(Cl)cc2N1 |
| InChI | InChI=1S/C13H12ClNO4S/c14-10-5-11-8(4-12(16)15-11)3-9(10)13(17)7-1-2-20(18,19)6-7/h3,5,7H,1-2,4,6H2,(H,15,16) |
| InChIKey | MGXZBQDPVOJPKJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |