C14H19N5O3S — CID 6491357
N,N-diethyl-2-[5-(4-methylsulfonylphenyl)tetrazol-2-yl]acetamide (PubChem CID 6491357) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is N,N-diethyl-2-[5-(4-methylsulfonylphenyl)tetrazol-2-yl]acetamide.
| Compound Name | N,N-diethyl-2-[5-(4-methylsulfonylphenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 6491357 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N,N-diethyl-2-[5-(4-methylsulfonylphenyl)tetrazol-2-yl]acetamide |
| SMILES | CCN(CC)C(=O)Cn1nnc(-c2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C14H19N5O3S/c1-4-18(5-2)13(20)10-19-16-14(15-17-19)11-6-8-12(9-7-11)23(3,21)22/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | PLWFNWIGWNVIJJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |