C21H17NO5 — CID 6491479
(4E)-2-(4-methoxyphenyl)-4-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 6491479) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is (4E)-2-(4-methoxyphenyl)-4-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(4-methoxyphenyl)-4-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6491479 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (4E)-2-(4-methoxyphenyl)-4-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | C#CCOc1ccc(/C=C2/N=C(c3ccc(OC)cc3)OC2=O)cc1OC |
| InChI | InChI=1S/C21H17NO5/c1-4-11-26-18-10-5-14(13-19(18)25-3)12-17-21(23)27-20(22-17)15-6-8-16(24-2)9-7-15/h1,5-10,12-13H,11H2,2-3H3/b17-12+ |
| InChIKey | KYZUMPMSZVTIAR-SFQUDFHCSA-N |
| XLogP | 3.06 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|