C14H17BrFNO — CID 64920634
4-bromo-N-(2,3-dimethylcyclopentyl)-3-fluorobenzamide (PubChem CID 64920634) has the molecular formula C14H17BrFNO and a molecular weight of 314.20 g/mol. Its IUPAC name is 4-bromo-N-(2,3-dimethylcyclopentyl)-3-fluorobenzamide.
| Compound Name | 4-bromo-N-(2,3-dimethylcyclopentyl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 64920634 |
| Molecular Formula | C14H17BrFNO |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 4-bromo-N-(2,3-dimethylcyclopentyl)-3-fluorobenzamide |
| SMILES | CC1CCC(NC(=O)c2ccc(Br)c(F)c2)C1C |
| InChI | InChI=1S/C14H17BrFNO/c1-8-3-6-13(9(8)2)17-14(18)10-4-5-11(15)12(16)7-10/h4-5,7-9,13H,3,6H2,1-2H3,(H,17,18) |
| InChIKey | LZDKVKWBJZVONO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |