C16H23ClN2 — CID 64926315
1-[1-(3-chlorophenyl)ethyl]-3-cyclopropyl-3-methylpiperazine (PubChem CID 64926315) has the molecular formula C16H23ClN2 and a molecular weight of 278.83 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)ethyl]-3-cyclopropyl-3-methylpiperazine.
| Compound Name | 1-[1-(3-chlorophenyl)ethyl]-3-cyclopropyl-3-methylpiperazine |
|---|---|
| PubChem CID | 64926315 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-[1-(3-chlorophenyl)ethyl]-3-cyclopropyl-3-methylpiperazine |
| SMILES | CC(c1cccc(Cl)c1)N1CCNC(C)(C2CC2)C1 |
| InChI | InChI=1S/C16H23ClN2/c1-12(13-4-3-5-15(17)10-13)19-9-8-18-16(2,11-19)14-6-7-14/h3-5,10,12,14,18H,6-9,11H2,1-2H3 |
| InChIKey | KMJSYMSVKAIBFR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |