C17H26N2O2 — CID 64930805
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5,5-dimethyl-2-propan-2-ylpiperazine (PubChem CID 64930805) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5,5-dimethyl-2-propan-2-ylpiperazine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5,5-dimethyl-2-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 64930805 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5,5-dimethyl-2-propan-2-ylpiperazine |
| SMILES | CC(C)C1CNC(C)(C)CN1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H26N2O2/c1-12(2)14-10-18-17(3,4)11-19(14)13-5-6-15-16(9-13)21-8-7-20-15/h5-6,9,12,14,18H,7-8,10-11H2,1-4H3 |
| InChIKey | OVWRZPZQHHTANW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|