C11H19N3S — CID 64933085
2-[(2-ethylpiperazin-1-yl)methyl]-4-methyl-1,3-thiazole (PubChem CID 64933085) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-[(2-ethylpiperazin-1-yl)methyl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[(2-ethylpiperazin-1-yl)methyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 64933085 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-[(2-ethylpiperazin-1-yl)methyl]-4-methyl-1,3-thiazole |
| SMILES | CCC1CNCCN1Cc1nc(C)cs1 |
| InChI | InChI=1S/C11H19N3S/c1-3-10-6-12-4-5-14(10)7-11-13-9(2)8-15-11/h8,10,12H,3-7H2,1-2H3 |
| InChIKey | ARMWGQDLBHYLFX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |