C17H30N2O2 — CID 64959090
3-tert-butyl-1-(2,3-dimethylcyclohexyl)-1,4-diazepane-2,5-dione (PubChem CID 64959090) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-tert-butyl-1-(2,3-dimethylcyclohexyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-tert-butyl-1-(2,3-dimethylcyclohexyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64959090 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 3-tert-butyl-1-(2,3-dimethylcyclohexyl)-1,4-diazepane-2,5-dione |
| SMILES | CC1CCCC(N2CCC(=O)NC(C(C)(C)C)C2=O)C1C |
| InChI | InChI=1S/C17H30N2O2/c1-11-7-6-8-13(12(11)2)19-10-9-14(20)18-15(16(19)21)17(3,4)5/h11-13,15H,6-10H2,1-5H3,(H,18,20) |
| InChIKey | ZTXAEGWJQCPVJW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |