C14H18N2O2S — CID 64961812
3,3-dimethyl-1-(3-methylsulfanylphenyl)-1,4-diazepane-2,5-dione (PubChem CID 64961812) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 3,3-dimethyl-1-(3-methylsulfanylphenyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3,3-dimethyl-1-(3-methylsulfanylphenyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64961812 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3,3-dimethyl-1-(3-methylsulfanylphenyl)-1,4-diazepane-2,5-dione |
| SMILES | CSc1cccc(N2CCC(=O)NC(C)(C)C2=O)c1 |
| InChI | InChI=1S/C14H18N2O2S/c1-14(2)13(18)16(8-7-12(17)15-14)10-5-4-6-11(9-10)19-3/h4-6,9H,7-8H2,1-3H3,(H,15,17) |
| InChIKey | AULXFMMYAMTCTM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |