C13H13Cl3N2O2 — CID 64961977
3-ethyl-1-(2,4,5-trichlorophenyl)-1,4-diazepane-2,5-dione (PubChem CID 64961977) has the molecular formula C13H13Cl3N2O2 and a molecular weight of 335.62 g/mol. Its IUPAC name is 3-ethyl-1-(2,4,5-trichlorophenyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-ethyl-1-(2,4,5-trichlorophenyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64961977 |
| Molecular Formula | C13H13Cl3N2O2 |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 3-ethyl-1-(2,4,5-trichlorophenyl)-1,4-diazepane-2,5-dione |
| SMILES | CCC1NC(=O)CCN(c2cc(Cl)c(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C13H13Cl3N2O2/c1-2-10-13(20)18(4-3-12(19)17-10)11-6-8(15)7(14)5-9(11)16/h5-6,10H,2-4H2,1H3,(H,17,19) |
| InChIKey | XZXUOVLUGAFTLX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|