C26H26F3NO4 — CID 6496619
4-(2,5-dimethoxyphenyl)-7,7-dimethyl-1-[3-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 6496619) has the molecular formula C26H26F3NO4 and a molecular weight of 473.49 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-7,7-dimethyl-1-[3-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 4-(2,5-dimethoxyphenyl)-7,7-dimethyl-1-[3-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 6496619 |
| Molecular Formula | C26H26F3NO4 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-7,7-dimethyl-1-[3-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | COc1ccc(OC)c(C2CC(=O)N(c3cccc(C(F)(F)F)c3)C3=C2C(=O)CC(C)(C)C3)c1 |
| InChI | InChI=1S/C26H26F3NO4/c1-25(2)13-20-24(21(31)14-25)19(18-11-17(33-3)8-9-22(18)34-4)12-23(32)30(20)16-7-5-6-15(10-16)26(27,28)29/h5-11,19H,12-14H2,1-4H3 |
| InChIKey | RCTQADJSXQOSHD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |