C13H21N3O2 — CID 64966804
1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1,4-diazepane-2,5-dione (PubChem CID 64966804) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1,4-diazepane-2,5-dione.
| Compound Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64966804 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1,4-diazepane-2,5-dione |
| SMILES | O=C1CCN(C2CCN3CCCCC23)C(=O)CN1 |
| InChI | InChI=1S/C13H21N3O2/c17-12-5-8-16(13(18)9-14-12)11-4-7-15-6-2-1-3-10(11)15/h10-11H,1-9H2,(H,14,17) |
| InChIKey | XZQTYXGWKKYOSK-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |