C11H15NO4 — CID 64973985
3-(ethoxycarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 64973985) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 3-(ethoxycarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-(ethoxycarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 64973985 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-(ethoxycarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CCONC(=O)C1C2C=CC(C2)C1C(=O)O |
| InChI | InChI=1S/C11H15NO4/c1-2-16-12-10(13)8-6-3-4-7(5-6)9(8)11(14)15/h3-4,6-9H,2,5H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | CZZVZKPPBUDQFU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|