C11H13N3O2 — CID 64974312
1-(4-methyl-1,2,5-oxadiazol-3-yl)-N-phenylmethoxymethanamine (PubChem CID 64974312) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-(4-methyl-1,2,5-oxadiazol-3-yl)-N-phenylmethoxymethanamine.
| Compound Name | 1-(4-methyl-1,2,5-oxadiazol-3-yl)-N-phenylmethoxymethanamine |
|---|---|
| PubChem CID | 64974312 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-(4-methyl-1,2,5-oxadiazol-3-yl)-N-phenylmethoxymethanamine |
| SMILES | Cc1nonc1CNOCc1ccccc1 |
| InChI | InChI=1S/C11H13N3O2/c1-9-11(14-16-13-9)7-12-15-8-10-5-3-2-4-6-10/h2-6,12H,7-8H2,1H3 |
| InChIKey | OBCQEWWGEWAKSQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|