C11H17NO3 — CID 64974978
1-(3,4-dimethoxyphenyl)-N-ethoxymethanamine (PubChem CID 64974978) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-ethoxymethanamine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-ethoxymethanamine |
|---|---|
| PubChem CID | 64974978 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-ethoxymethanamine |
| SMILES | CCONCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C11H17NO3/c1-4-15-12-8-9-5-6-10(13-2)11(7-9)14-3/h5-7,12H,4,8H2,1-3H3 |
| InChIKey | VTKGYSAUMPOKKS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|